| Identification |
| Name: | 2-Propenoic acid,2-methyl-,esters,oxiranylmethyl ester,polymer with ethene and methyl 2-propenoate |
| Synonyms: | 2-propenoicacid,2-methyl-,oxiranylmethylester,polymerwithetheneandmeth;2-Propenoicacid,2-methyl-,oxiranylmethylester,polymerwithetheneandmethyl2-propenoate;poly(ethylene-co-methylacrylate-co-glycidylmeth;POLY(ETHYLENE-CO-METHYL ACRYLATE-CO-GLYCIDYL METHACRYLATE);ETHYLENE-GLYCIDYL METHACRYLATE-METHYL ACRYLATE COPOLYMER;2-Methyl-2-propenoic acid, oxiranylmethyl ester polymer with ethene and methyl 2-propenoate;glycidyl methacrylate/ methyl acrylate/ ethylene copolymer |
| CAS: | 51541-08-3 |
| Molecular Formula: | C13H20O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H10O3.C4H6O2.C2H4/c1-5(2)7(8)10-4-6-3-9-6;1-3-4(5)6-2;1-2/h6H,1,3-4H2,2H3;3H,1H2,2H3;1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 39 °C(lit.)
|
| Flash Point: | 76.1°C |
| Boiling Point: | 189°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 76.1°C |
| Safety Data |
| |
 |