| Identification | |
| Name: | Benzene,1-bromo-4-pentyl- |
| Synonyms: | 1-Bromo-4-pentylbenzene;4-n-Pentylbromobenzene;p-Pentylbromobenzene;p-Pentylphenyl bromide; |
| CAS: | 51554-95-1 |
| EINECS: | 472-220-9 |
| Molecular Formula: | C11H15Br |
| Molecular Weight: | 227.14 |
| InChI: | InChI=1/C11H15Br/c1-2-3-4-5-10-6-8-11(12)9-7-10/h6-9H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 192? |
| Density: | 1.272 |
| Refractive index: | 1.5260 |
| Appearance: | Clear pale yellow liquid |
| Specification: |
4-Pentylbromobenzene , its cas register number is 51554-95-1. It also can be called 1-Bromo-4-pentylbenzene ; and 1-Amyl-4-bromobenzene . |
| Flash Point: | 192? |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
 |
|
