| Identification | |
| Name: | DL-Valine |
| Synonyms: | DL-2-Amino-3-methylbutyric acid; Val; DL-2-Aminoisovaleric acid~(+/-)-2-Amino-3-methylbutyric acid; H-DL-Val-OH; DL-2-Aminoisovaleric acid~(+/-)-2-Amino-3-methylbutyric acid~H-DL-Val-OH |
| CAS: | 516-06-3 |
| EINECS: | 208-220-0 |
| Molecular Formula: | C5H11NO2 |
| Molecular Weight: | 117.15 |
| InChI: | InChI=1/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 83 oC |
| Boiling Point: | 68 (g/l) |
| Density: | 1.31 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.461 |
| Water Solubility: | 68 g/L |
| Solubility: | Appearance:white crystals Transport Information: OTH Hazard Symbols:Not regulated UN NO. |
| Appearance: | white crystals |
| Specification: | White crystalline powder Safety Statements:22-24/25-36 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing |
| HS Code: | 29224995 |
| Flash Point: | 83 oC |
| Storage Temperature: | Store at RT. |
| Usage: | L form is an essential amino acid in humans. |
| Safety Data | |
| Hazard Symbols | |
 |
|
