| Identification | |
| Name: | Benzeneacetonitrile,3-phenoxy- |
| Synonyms: | (3-Phenoxyphenyl)acetonitrile;3-Phenoxybenzeneacetonitrile; 3-Phenoxybenzyl cyanide; m-Phenoxybenzyl cyanide |
| CAS: | 51632-29-2 |
| EINECS: | -0 |
| Molecular Formula: | C14H11 N O |
| Molecular Weight: | 209.24 |
| InChI: | InChI=1/C14H11NO/c15-10-9-12-5-4-8-14(11-12)16-13-6-2-1-3-7-13/h1-8,11H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Flash Point: | 113 ºC |
| Density: | 1.124 |
| Refractive index: | 1.578 |
| Specification: | Safety Statements:23-26-36 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Flash Point: | 113 ºC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
