| Identification |
| Name: | Selenocyanic acid,2-nitrophenyl ester |
| Synonyms: | 2-Nitrophenylselenocyanate;o-Nitrophenyl selenocyanate;o-Nitrophenyl selenocyanide;o-Nitrophenylselenyl cyanide;2-Nitrophenyl selenocyanic acid;Selenocyanic acid, 2-nitrophenyl ester; |
| CAS: | 51694-22-5 |
| EINECS: | 257-350-4 |
| Molecular Formula: | C7H4N2O2Se |
| Molecular Weight: | 227.07886 |
| InChI: | InChI=1S/C7H4N2O2Se/c8-5-12-7-4-2-1-3-6(7)9(10)11/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3282 6.1/PG 3 |
| Melting Point: | 140-142 °C(lit.) |
| Flash Point: | 345.2°Cat760mmHg |
| Boiling Point: | 345.2°Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with acids, strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with acids, strong oxidizing agents. Toxicology Toxic - may be fatal if swallowed, inhaled or absorbed throughthe skin. Toxicity data |
| Solubility: | Stability Stable. Incompatible with acids, strong oxidizing agents. Toxicology Toxic - may be fatal if swallowed, inhaled or absorbed throughthe skin. Toxicity data |
| Appearance: | dark brown crystalline solid |
| Packinggroup: | II |
| Flash Point: | 345.2°Cat760mmHg |
| Color: | brown |
| Safety Data |
| |
 |
