| Identification | |
| Name: | Estra-4,9-diene-3,17-dione |
| Synonyms: | 19-Norandrosta-4,9-diene-3,17-dione; |
| CAS: | 5173-46-6 |
| Molecular Formula: | C19H20O2 |
| Molecular Weight: | 280.36 |
| InChI: | InChI=1/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,15-16H,2-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.16 g/cm3 |
| Refractive index: | 1.575 |
| Appearance: | white or almost white crystalline powder |
| Specification: |
?Estra-4,9-diene-3,17-dione (CAS NO.5173-46-6) is also named as 19-norandrosta-4,9-diene-3,17-dione .?Estra-4,9-diene-3,17-dione (CAS NO.5173-46-6) is white or almost white crystalline powder. |
| Storage Temperature: | Refrigerator |
| Usage: | A potential metabolitie of STS 557 (Dienogest). A steroid with antiglucocorticoid activity |
| Safety Data | |
 |
|
