| Identification |
| Name: | Fluorescein sodium |
| Synonyms: | Acid Yellow 73~C.I. 45350; C.I. 45350; Fluorescein Sodium Salt; Uranine; Fluorescein disodium salt hydrate; C.I. Acid Yellow 73; Acid Yellow 73 (C.I.); disodium 2-(3-oxo-6-oxidoxanthen-9-yl)benzoate; Fluorescein; Acid Yellow 73; Uranin; 11824 yellow; 12417 yellow; ful-glo; funduscein; furanium; hidacid uranine; Soap yellow; C.I. 45350 sodium salt; sodium fluoresceinate; fluorescein sodium b.p; sodium salt of hydroxy-o-carboxy-phenyl-fluorone; resorcinol phthalein sodium; Fluorescein, sodium derivative, sodium salt; Soluble fluorescein; Uranine A Extra; Uranine K; Uranine O; Uranine SS; Uranine USP XII; Uranine WSS; Uranine Yellow; Yellow no. 8; 3',6'-Dihydroxy-spiro[3H-isobenzofuran-1,9'-xanthen]-3-one disodium salt; 3',6'-dihydroxyspiro[isobenzofuran-1(3H),9'-(9H)xanthene]-3-one, disodium salt; 3,6-Dihydroxyxanthene-9-spiro-1'-3'H-isobenzofuran-3'-one; 3,6-Dihydroxyxanthene-9-spiro-1'-3'H-isobenzofuran-3'-one dipotassium salt; 3,6-Dihydroxyxanthene-9-spiro-1'-3'H-isobenzofuran-3'-one disodium salt; 9-(o-Carboxyphenyl)-3,6-dihydroxyxanthylium dipotassium salt; 9-(o-Carboxyphenyl)-3,6-dihydroxyxanthylium disodium salt; 9-o-carboxyphenyl-6-hydroxy-3-isoxanthone, disodium salt; Acid Yellow 73; aizen uranine; Dihydroxyspiro[isobenzofuran-1(3H),9'-(9H)xanthen]-3-one disodium salt; disodium 6-hydroxy-3-oxo-9-xanthene-o-benzoate; calcocid uranine b4315; certiqual fluoresceine; C.I. 45350 disodium salt; C.I. 766; d&c yellow no. 8; fluorescein, disodium salt; fluorescein, water soluble; Fluorescein W/S; fluor-i-strip a.t.; Fluorone |
| CAS: | 518-47-8 |
| EINECS: | 208-253-0 |
| Molecular Formula: | C20H12O5?2Na |
| Molecular Weight: | 376.27 |
| InChI: | InChI=1/C20H12O5.2Na/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24;;/h1-10,21H,(H,23,24);;/q;2*+1/p-2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Flash Point: | 232.6 oC |
| Boiling Point: | 620.8oC at 760 mmHg |
| Density: | 1.601 g/cm3 (20 C) |
| Stability: | Stable. |
| Solubility: | Freely Souluble (600 g/l) SOLVENT |
| Appearance: | orange powder |
| Report: |
Reported in EPA TSCA Inventory.
|
| HS Code: | 32041200 |
| Flash Point: | 232.6 oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Red, orthorhombic prisms Yellowish-red to red powder Orange-red, crystalline powder |
| Usage: | Dye, ink pigment, in cosmetic products. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |