| Identification | |
| Name: | Tris-(2-carboxyethyl)-phosphine hydrochloride |
| Synonyms: | Tris(2-carboxyethyl)phosphine hydrochloride |
| CAS: | 51805-45-9 |
| Molecular Formula: | C9H16ClO6P |
| Molecular Weight: | 286.64 |
| InChI: | InChI=1/C9H15O6P/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15/h1-6H2,(H,10,11)(H,12,13)(H,14,15)/p-3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Melting Point: | 177 °C |
| Flash Point: | 267.9°C |
| Boiling Point: | 519.4°C at 760 mmHg |
| Density: | 1.041 g/mL at 25 °C |
| Refractive index: | n20/D 1.367 |
| Packinggroup: | III |
| Flash Point: | 267.9°C |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Usage: |
1. Tris(2-carboxyethyl)phosphine hydrochloride (51805-45-9) can be used as biochemical tool for selective reduction of disulfide bridges at low pH. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
