| Identification | |
| Name: | 3',5'-Dihydroxyacetophenone |
| Synonyms: | Acetophenone,3',5'-dihydroxy- (7CI);1-(3,5-Dihydroxyphenyl)ethanone;3,5-Dihydroxyacetophenone; |
| CAS: | 51863-60-6 |
| EINECS: | 257-480-1 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c1-5(9)6-2-7(10)4-8(11)3-6/h2-4,10-11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.291 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.595 |
| Appearance: | White to off-white crystalline powder |
| Specification: |
?1-(3,5-Dihydroxyphenyl)ethan-1-one , its cas register number is 51863-60-6. It also can be called 1-(3,5-Dihydroxyphenyl)-ethanone ; Ethanone, 1-(3,5-dihydroxyphenyl)- .It is a?white to light yellow crystal powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
