| Identification |
| Name: | Benzene,1,1',1''-methylidynetris- |
| Synonyms: | Methane,triphenyl- (8CI);1,1',1''-Methylidynetris[benzene];NSC 4049;Triphenylmethane;Tritane; |
| CAS: | 519-73-3 |
| EINECS: | 208-275-0 |
| Molecular Formula: | C19H16 |
| Molecular Weight: | 244.33 |
| InChI: | InChI=1/C19H16/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H |
| Molecular Structure: |
![(C19H16) Methane,triphenyl- (8CI);1,1',1''-Methylidynetris[benzene];NSC 4049;Triphenylmethane;Tritane;](https://img.guidechem.com/casimg/519-73-3.gif) |
| Properties |
| Flash Point: | 160.3°C |
| Density: | 1.014 |
| Stability: | Stable; combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.59546 (20 C) |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | faint yellow powder. |
| HS Code: | 29029080 |
| Flash Point: | 160.3°C |
| Storage Temperature: | 2-8°C |
| Usage: | Production of triarylmethane dyes. |
| Safety Data |
| |
 |
