| Identification | |
| Name: | 5-Aminoindole |
| Synonyms: | Indol-5-ylamine;Indole, 5-amino-;1H-Indol-5-amine;5-Amino indole;5-Amino-1H-indole; |
| CAS: | 5192-03-0 |
| EINECS: | 225-977-2 |
| Molecular Formula: | C8H8N2 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C8H8N2/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.268g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.757 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Off-white powder. |
| Specification: | Grey Crystals Safety Statements:26-45-36/37 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves |
| HS Code: | 29339990 |
| Sensitive: | Air & Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
