| Identification | |
| Name: | 4-Thiazolecarboxaldehyde,2-bromo- |
| Synonyms: | 2-Bromo-4-thiazolecarboxaldehyde;2-Bromo-4-fomylthiazole;2-Bromo-1,3-thiazole-4-carbaldehyde; |
| CAS: | 5198-80-1 |
| Molecular Formula: | C4H2BrNOS |
| Molecular Weight: | 192.03 |
| InChI: | InChI=1/C4H2BrNOS/c5-4-6-3(1-7)2-8-4/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 132-135 |
| Density: | 1.92g/cm3 |
| Refractive index: | 1.666 |
| Specification: |
2-Bromo-4-fomylthiazole with cas registry number of 5198-80-1 is also known as 2-Thiazolecarboxaldehyde, 4-bromo- ; 4-Bromo-1,3-thiazole-2-carbaldehyde ; 4-Bromo-2-formylthiazole ; 4-Bromothiazole-2-carboxaldehyde . It is a compound used as an intermediate . |
| Storage Temperature: | Keep Cold |
| Safety Data | |
 |
|
