| Identification | |
| Name: | L-Cysteine |
| Synonyms: | L-Cysteine Free Base;2-Amino-3-mercapto-, (R)-;L-Cysteine (JAN);L-Cysteine Base/Hcl (mono/anhyd);(2R)-2-amino-3-mercaptopropanoic acid;Valine,3-mercapto-;alpha-Amino-beta-mercaptopropionic acid, L-;alpha-Amino-beta-thiolpropionic acid, L-;L-2-Amino-3-mercaptopropanoic acid;(2R)-2-amino-3-sulfanyl-propanoic acid;Half-cystine;L-2-Amino-3-mercaptopropionic acid;L-Cysteine Base;(+)-2-Amino-3-mercaptopropionic acid;H-Cys-OH; |
| CAS: | 52-90-4 |
| EINECS: | 200-158-2 |
| Molecular Formula: | C3H7NO2S |
| Molecular Weight: | 121.15 |
| InChI: | InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.334 g/cm3 |
| Stability: | Stability Stable, but may be air sensitive. Incompatible with oxidizing agents, bases. |
| Alpha: | 8.75 o (C=12, 2N HCL) |
| Appearance: | White crystalline powder |
| Specification: | White crystalline powder Safety Statements:36-37/39-26 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29309012 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Air Sensitive |
| Color: | Colorless crystals White crystals |
| Usage: | Biochemical and nutrition research, reducing agent in bread doughs (up to 90 ppm). |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
