| Identification | |
| Name: | Hesperetin |
| Synonyms: | (2S)-5,7-dihydroxy-2-(3-hydroxy-4-methoxy-phenyl)chroman-4-one;(S)-2,3-Dihydro-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-benzopyrone;Flavanone, 3,5, 7-trihydroxy-4-methoxy-;5,7-dihydroxy-2-(3-hydroxy-4-methoxy-phenyl)chroman-4-one;Flavanone, 3,5,7-trihydroxy-4-methoxy- (VAN) (8CI);4H-1-Benzopyran-4-one,2,3-dihydro-5,7- dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-,(2S)-;5,7,3-Trihydroxy-4-methoxyflavanone;Prestwick_908;3,5,7-Trihydroxy-4-methoxyflavanone;4H-1-Benzopyran-4-one, 2,3-dihydro-5, 7-dihydroxy-2- (3-hydroxy-4-methoxyphenyl)-, (S)-;5,7, 3-Trihydroxy-4-methoxyflavanone;Cyanidanon 4-methyl ether 1626; |
| CAS: | 520-33-2 |
| EINECS: | 208-290-2 |
| Molecular Formula: | C16H14O6 |
| Molecular Weight: | 302.284 g/mol |
| InChI: | InChI=1S/C16H14O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-6,14,17-19H,7H2,1H3/t14-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.458 g/cm3 |
| Refractive index: | -4 ° (C=1.8, EtOH) |
| Water Solubility: | water-soluble |
| Solubility: | water-soluble |
| Appearance: | Beige to Light Brown Crystalline Solid |
| Specification: |
Hesperetin (CAS NO.520-33-2) is a bioflavonoid and specificly it is a flavanone. Hesperidin is water-soluble due to the presence of the sugar part in its structure, so on ingestion it releases its aglycone, i.e, hesperetin. |
| Storage Temperature: | 2-8°C |
| Usage: | The aglucon of hesperidin |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
