| Identification | |
| Name: | 3-Pyridinamine,6-ethoxy- |
| Synonyms: | Pyridine,5-amino-2-ethoxy- (7CI);2-Ethoxy-5-aminopyridine;5-Amino-2-ethoxypyridine;6-Ethoxypyridin-3-ylamine; |
| CAS: | 52025-34-0 |
| Molecular Formula: | C7H10N2O |
| Molecular Weight: | 138.17 |
| InChI: | InChI=1S/C7H10N2O/c1-2-10-7-4-3-6(8)5-9-7/h3-5H,2,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.101 g/cm3 |
| Specification: |
3-Pyridinamine,6-ethoxy- , its cas register number is 52025-34-0. It also can be called 4-22-00-05573 (Beilstein Handbook Reference) ; 5-Amino-2-ethoxypyridine ; BRN 0116585 . 3-Pyridinamine,6-ethoxy- (CAS NO.52025-34-0) is harmful by inhalation, in contact with skin and if swallowed. So you should wear suitable protective clothing. |
| Safety Data | |
 |
|
