| Identification |
| Name: | Acetic acid, compd. with N,N-diethylethanamine (1:1) |
| Synonyms: | Aceticacid,compd.withN,N-diethylethanamine(1:1);aceticacid:triethylamine2m:2mconcen-trate;Ethanamine,N,N-diethyl-,acetate;triethylammonium;TEAA;TRIETHYLAMINE ACETATE;TRIETHYLAMINE:ACETIC ACID 1M:2M;TRIETHYLAMINE:ACETIC ACID 2M:2M |
| CAS: | 5204-74-0 |
| EINECS: | 225-995-0 |
| Molecular Formula: | C8H19NO2 |
| Molecular Weight: | 161.242 |
| InChI: | InChI=1/C6H15N.C2H4O2/c1-4-7(5-2)6-3;1-2(3)4/h4-6H2,1-3H3;1H3,(H,3,4) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2790 8 |
| Melting Point: | -114.7 deg C |
| Stability: | Stable. Incompatible with strong oxidizing agents, bases. |
| Refractive index: | n20/D 1.357 |
| Solubility: | |
| Appearance: | colourless liquid |
| Storage Temperature: | 2-8°C |
| Color: | Colorless liquid |
| Safety Data |
| |
 |
