| Identification | |
| Name: | Dimethylamino propyl methacrylamide |
| Synonyms: | Dimethylaminopropyl methacrylamide (DMAPMA); N-[3-(Dimethylamino)propyl]methacrylamide; DMAPMA; Dimethylaminopropyl methacrylamide |
| CAS: | 5205-93-6 |
| EINECS: | 226-002-3 |
| Molecular Formula: | C9H18N2O |
| Molecular Weight: | 170.25202 |
| InChI: | InChI=1S/C9H18N2O/c1-8(2)9(12)10-6-5-7-11(3)4/h1,5-7H2,2-4H3,(H,10,12) |
| Molecular Structure: | ![(C9H18N2O) Dimethylaminopropyl methacrylamide (DMAPMA); N-[3-(Dimethylamino)propyl]methacrylamide; DMAPMA; Dime...](https://img.guidechem.com/casimg/5205-93-6.gif) |
| Properties | |
| Density: | 0.94 |
| Refractive index: | 1.479 |
| Water Solubility: | soluble in water and most organic solvents. |
| Solubility: | soluble in water and most organic solvents. |
| Appearance: | colorless to light yellowliquid |
| Specification: |
Dimethylamino propyl methacrylamide , its cas register number is 5205-93-6. It also can be called 2-Propenamide,N-[3-(dimethylamino)propyl]-2-methyl- ; N-[3-(Dimethylamino)propyl]-2-methacrylamide ; 2-Propenamide, N-(3-(dimethylamino)propyl)-2-methyl- ; N-(3-(Dimethylamino)propyl)methacrylamide . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
