| Identification | |
| Name: | 2-Bromo-4-nitropyridine 1-oxide |
| Synonyms: | 2-Bromo-4-nitropyridine-n-oxide;2-Bromo-4-nitropyridine 1-oxide; 2-Bromo-4-nitropyridine N-oxide;2-Bromo-4-nitropyridine N-oxide;6-bromo-4-nitro-6H-pyridine 1-oxide; |
| CAS: | 52092-43-0 |
| EINECS: | -0 |
| Molecular Formula: | C5H3BrN2O3 |
| Molecular Weight: | 218.99 |
| InChI: | InChI=1/C5H4BrN2O3/c6-5-3-4(8(10)11)1-2-7(5)9/h1-3,5H/q+1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.98 g/cm3 |
| Specification: |
2-Bromo-4-nitropyridine N-oxide (52092-43-0) is known as pyridine nitrogen oxide,is the chemical compound with the formula C5H3BrN2O3.It is a very good organic intermediate and can be used in pharmacy. |
| Packinggroup: | III |
| Safety Data | |
 |
|
