| Identification | ||
| Name: | 3-Aminophthalhydrazide | |
| Synonyms: | 5-Amino-2,3-dihydro-1,4-phthalazinedione~Luminol; Luminol 3-Aminophthalhydrazide; 5-amino-2,3-dihydro-1,4-*phthalazinedione free ac; 5-amino-1,2,3,4-tetrahydrophthalazine-1,4-dione; Luminol; RARECHEM AH BS 0053; AURORA KA-3798; LABOTEST-BB LT00645356; LUMINOL; 3-AMINOPHTHALHYDRAZINE; 3-AMINOPHTHALIC HYDRAZIDE; 3-AMINOPHTHALOYLHYDRAZINE; 3-AMINOPHTHALHYDRAZIDE; 2,3-Dihydro-5-nitro-4-phthalazinedione | |
| CAS: | 521-31-3 | |
| EINECS: | 208-309-4 | |
| Molecular Formula: | C8H7N3O2 | |
| Molecular Weight: | 177.16 | |
| InChI: | InChI=1/C8H7N3O2/c9-5-3-1-2-4-6(5)8(13)11-10-7(4)12/h1-3H,9H2,(H,10,12)(H,11,13) | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.433 g/cm3 | |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong acids, strong bases, strong reducing agents. Emits light on reaction with oxidizers. | |
| Water Solubility: | <0.1 g/100 mL at 19 ºC | |
| Solubility: | <0.1 g/100 mL at 19 oC | |
| Appearance: | yellow to green | |
| Specification: |
? 5-Amino-2,3-dihydro-1,4-phthalazinedione (CAS NO.521-31-3), its Synonyms are 1,2-Benzenedicarboxylic acid, 3-amino-, cyclic hydrazide ; 3-Aminophthalhydrazide ; 3-Aminophthalic acid hydrazide ; 3-Aminophthalic hydrazide ; 1,4-Phthalazinedione, 5-amino-2,3-dihydro- ; Luminol . It is yellow crystals or light beige powder. | |
| Report: |
Reported in EPA TSCA Inventory. | |
| HS Code: | 29339990 | |
| Usage: | Detection of copper, iron, peroxides, cyanides. Location of blood on forensic samples. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
