| Identification | |
| Name: | 2-Propanone,1-(2-methoxyphenyl)- |
| Synonyms: | 2-Propanone,(o-methoxyphenyl)- (6CI,7CI);2-Propanone, 1-(o-methoxyphenyl)- (8CI);(2-Methoxyphenyl)acetone;1-(2-Anisyl)-2-propanone;1-(2-Methoxyphenyl)-2-propanone;1-(o-Methoxyphenyl)-2-propanone;2'-Methoxyphenyl-2-propanone;o-Methoxyphenyl-2-propanone; |
| CAS: | 5211-62-1 |
| EINECS: | 226-008-6 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.054 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.525 |
| Appearance: | Colorless liquid. |
| Specification: |
2-Methoxyphenylacetone (5211-62-1) also can be called for o-Methoxy phenyl acetone ; 1-(2-Methoxyphenyl)acetone ; 2-Propanone, 1-(2-methoxyphenyl)- ; 2-Methoxyphenylpropan-2-one . It can be obtained from O-methoxybenzaldehyde by condensation, reduction, hydrolysis, and can be used for intermediate of Methoxy Non-That-ming. |
| HS Code: | 29145000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
