Identification |
Name: | 2,4-Imidazolidinedione,5-hydroxy-1-[[[5-(4-nitrophenyl)-2-furanyl]methylene]amino]- |
Synonyms: | 5-Hydroxy-dantrolene |
CAS: | 52130-25-3 |
Molecular Formula: | C14H10 N4 O6 |
Molecular Weight: | 330.2524 |
InChI: | InChI=1/C14H10N4O6/c19-12-13(20)17(14(21)16-12)15-7-10-5-6-11(24-10)8-1-3-9(4-2-8)18(22)23/h1-7,13,20H,(H,16,19,21)/b15-7+ |
Molecular Structure: |
|
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.68 g/cm3 |
Refractive index: | 1.739 |
Specification: | Yellow Solid usageEng:A metabolite of Dantrolene that has shown to have muscle relaxant effects |
Flash Point: | °C |
Usage: | A metabolite of Dantrolene that has shown to have muscle relaxant effects |
Safety Data |
|
|