| Identification | |
| Name: | 3-Pyridinecarbonitrile,1,2-dihydro-4-methoxy-1-methyl-2-oxo- |
| Synonyms: | Nicotinonitrile,1,2-dihydro-4-methoxy-1-methyl-2-oxo- (7CI,8CI); Ricinine (6CI);1,2-Dihydro-4-methoxy-1-methyl-2-oxonicotinonitrile; NSC 409913; NSC 642604;Recinine; Ricinin |
| CAS: | 524-40-3 |
| EINECS: | 208-359-7 |
| Molecular Formula: | C8H8 N2 O2 |
| Molecular Weight: | 164.16132 |
| InChI: | InChI=1S/C8H8N2O2/c1-10-4-3-7(12-2)6(5-9)8(10)11/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.23 g/cm3 |
| Refractive index: | 1.547 |
| Water Solubility: | soluble in water? methanol and ethanol; less in organic solvents |
| Solubility: | soluble in water? methanol and ethanol; less in organic solvents |
| Specification: | usageEng:An alkaloid extract from the seeds of the castor-oil plant (Ricinus communalis). It is a central nervous system stimulant that could potentially be a cognition-enhancing agent used for the treatment of human amnesias. It also has bactericidal effects on t |
| Usage: | An alkaloid extract from the seeds of the castor-oil plant (Ricinus communalis). It is a central nervous system stimulant that could potentially be a cognition-enhancing agent used for the treatment of human amnesias. It also has bactericidal effects on t |
| Safety Data | |
| Hazard Symbols | |
 |
|
