| Identification | |
| Name: | 3-Phenyl-3-pyrrolidineethanol |
| Synonyms: | 2-(3-Phenylpyrrolidin-3-yl)ethanol;3-pyrrolidineethanol, 3-phenyl-;LogP |
| CAS: | 52423-63-9 |
| Molecular Formula: | C12H17NO |
| Molecular Weight: | 191.27 |
| InChI: | InChI=1/C12H17NO/c14-9-7-12(6-8-13-10-12)11-4-2-1-3-5-11/h1-5,13-14H,6-10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 128.3°C |
| Boiling Point: | 328.8°C at 760 mmHg |
| Density: | 1.048 |
| Refractive index: | 1.537 |
| Specification: |
The 3-Phenyl-3-pyrrolidineethanol with its cas register number is 52423-63-9. The Systematic name about this chemical is 2-(3-phenylpyrrolidin-3-yl)ethanol. Physical properties about 3-Phenyl-3-pyrrolidineethanol are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 1; (4)ACD/KOC (pH 7.4): 1; (5)#H bond acceptors: 2; (6) #H bond donors: 2; (7)#Freely Rotating Bonds: 4; (8)Polar Surface Area: 32.26Å2; (9)Index of Refraction: 1.537; (10)Molar Refractivity: 57 cm3; (11)Molar Volume: 182.4 cm3; (12)Polarizability: 22.59x10-24cm3; (13)Surface Tension: 44.6 dyne/cm; (14)Enthalpy of Vaporization: 60.3 kJ/mol; (15)Vapour Pressure: 7.45E-05 mmHg at 25°C You can still convert the following datas into molecular structure: |
| Flash Point: | 128.3°C |
| Safety Data | |
 |
|
