| Identification | |
| Name: | Methanone,(2-butyl-3-benzofuranyl)(4-hydroxyphenyl)- |
| Synonyms: | Ketone,2-butyl-3-benzofuranyl p-hydroxyphenyl (6CI,7CI);L 3372;NSC 85438;(2-butyl-1-benzofuran-3-yl)(4-hydroxyphenyl)methanone;(2-Butylbenzofuran-3-yl)(4-hydroxyphenyl)ketone; |
| CAS: | 52490-15-0 |
| EINECS: | 257-959-5 |
| Molecular Formula: | C19H18O3 |
| Molecular Weight: | 294.34 |
| InChI: | InChI=1/C19H18O3/c1-2-3-7-17-18(15-6-4-5-8-16(15)22-17)19(21)13-9-11-14(20)12-10-13/h4-6,8-12,20H,2-3,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 119 °C |
| Flash Point: | 250.5°C |
| Boiling Point: | 490.6°Cat760mmHg |
| Density: | 1.183 |
| Refractive index: | 1.615 |
| Specification: | Off-White Solid usageEng:Inhibitor of enzyme |
| Flash Point: | 250.5°C |
| Storage Temperature: | Refrigerator |
| Usage: | Inhibitor of enzyme |
| Safety Data | |
 |
|
