| Identification | |
| Name: | Galactaric acid |
| Synonyms: | Mucic acid(6CI);Galactosaccharic acid;NSC 8127;Saccharolactic acid; |
| CAS: | 526-99-8 |
| EINECS: | 208-404-0 |
| Molecular Formula: | C6H10 O8 |
| Molecular Weight: | 210.14 |
| InChI: | InChI=1/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 431.2°C |
| Boiling Point: | 766.4°Cat760mmHg |
| Density: | 1.939g/cm3 |
| Refractive index: | 1.651 |
| Solubility: | Appearance:white to off-white crystalline powder Transport Information: OTH Hazard Symbols:UN NO. particular:particular |
| Appearance: | white to off-white crystalline powder |
| Specification: |
The chemical synonyms of 2,3,4,5-Tetrahydroxyhexanedioic acid (526-99-8) are Saccharolactic acid ; Tetrahydroxyhexanedioic acid ; Tetrahydroxyadipic acid ; Mucic acid ; Galactosaccharic acid ; Galactaric acid ; Galacteric acid ; Mucic acid ; D-galactaric acid ; Galactosaccharic acid ; Galactaric acid ; Galacteric acid . Some useful infamation about the operate and store of the product:Wear safety glasses and chemical goggles if splashing is possible.Wear safety glasses and chemical goggles if splashing is possible.Wear appropriate protective clothing to minimize contact with skin. Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Avoid contact with eyes, skin, and clothing. Avoid ingestion and inhalation.Store in a cool, dry place. Keep container closed when not in use. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 431.2°C |
| Storage Temperature: | Store at RT. |
| Color: | CRYSTALLINE POWDER PRISMS FROM WATER |
| Safety Data | |
| Hazard Symbols | |
 |
|
