| Identification | |
| Name: | Benzeneacetyl chloride,2,4,6-trimethyl- |
| Synonyms: | Acetylchloride, mesityl- (6CI,7CI);(2,4,6-Trimethylphenyl)acetyl chloride;2,4,6-Trimethylbenzeneacetyl chloride;Mesitylacetic acid chloride;Mesitylacetyl chloride;Mesityleneacetyl chloride;a-Mesitylacetyl chloride; |
| CAS: | 52629-46-6 |
| EINECS: | 224-556-0 |
| Molecular Formula: | C11H13ClO |
| Molecular Weight: | 134.13 |
| InChI: | InChI=1/C11H13ClO/c1-7-4-8(2)10(6-11(12)13)9(3)5-7/h4-5H,6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 167-168 ºC |
| Density: | 1.095 |
| Refractive index: | 1.526 |
| Specification: |
The Mesitylacetyl chloride with the cas number 52629-46-6 is also called Benzeneacetyl chloride,2,4,6-trimethyl-. The systematic name is (2,4,6-trimethylphenyl)acetyl chloride. Its molecular formula is C11H13ClO. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 3.10; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4; (4)ACD/LogD (pH 7.4): 4; (5)ACD/BCF (pH 5.5): 329; (6)ACD/BCF (pH 7.4): 329; (7)ACD/KOC (pH 5.5): 2203; (8)ACD/KOC (pH 7.4): 2203; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 17.07 Å2; (13)Index of Refraction: 1.526; (14)Molar Refractivity: 55.156 cm3; (15)Molar Volume: 179.581 cm3; (16)Polarizability: 21.865×10-24cm3; (17)Surface Tension: 36.14 dyne/cm; (18)Enthalpy of Vaporization: 52.088 kJ/mol; (19)Vapour Pressure: 0.003 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
