| Identification |
| Name: | 2-Thiophenecarboxylic acid |
| Synonyms: | 2-Thenoic acid; Thiophene-2-carboxylic acid; 2-Thiophenecaroxylic Acid |
| CAS: | 527-72-0 |
| EINECS: | 208-423-4 |
| Molecular Formula: | C5H4O2S |
| Molecular Weight: | 128.14 |
| InChI: | InChI=1/C5H4O2S/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 260 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | white to off-white powder |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
