| Identification | |
| Name: | 1-Methyl-3-phenyl-piperazine |
| Synonyms: | - |
| CAS: | 5271-27-2 |
| EINECS: | 432-360-3 |
| Molecular Formula: | C11H16N2 |
| Molecular Weight: | 176.26 |
| InChI: | InChI=1/C11H16N2/c1-13-8-7-12-11(9-13)10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3/p+2/t11-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2923 |
| Density: | 0.991 g/cm3 |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | Off-White Solid |
| Specification: | Off-White Solid usageEng:Piperazine derivative used as reference materials for forensic laboratories. They affect the central and the autonomic nervous systems, the blood pressure, and smooth muscle. Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Sensitive: | Air Sensitive |
| Usage: | Piperazine derivative used as reference materials for forensic laboratories. They affect the central and the autonomic nervous systems, the blood pressure, and smooth muscle. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
Xi:Irritant
|
 |
|
