| Identification | |
| Name: | 4-Piperidinecarboxylicacid, 3-oxo-1-(phenylmethyl)-, ethyl ester, hydrochloride (1:1) |
| Synonyms: | 4-Piperidinecarboxylicacid, 3-oxo-1-(phenylmethyl)-, ethyl ester, hydrochloride (9CI);1-Benzyl-4-carbethoxy-3-oxopiperidine hydrochloride;Ethyl1-benzyl-3-oxopiperidine-4-carboxylate hydrochloride;N-Benzyl-4-carbethoxy-3-piperidone hydrochloride;4-Piperidinecarboxylic acid, 3-oxo-1-(phenylmethyl)-, ethyl ester, hydrochloride (1:1);Ethyl 1-benzyl-3-oxopiperidine-4-carboxylate hydrochloride (1:1); |
| CAS: | 52763-21-0 |
| EINECS: | 258-162-5 |
| Molecular Formula: | C15H20ClNO3 |
| Molecular Weight: | 297.78 |
| InChI: | InChI=1/C15H19NO3/c1-2-19-15(18)13-8-9-16(11-14(13)17)10-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.154g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | brown crystalline powder. |
| Specification: |
Ethyl N-benzyl-3-oxo-4-piperidine-carboxylate hydrochloride , with CAS number of 52763-21-0, can be called 4-piperidinecarboxylic acid, 3-oxo-1-(phenylmethyl)-, ethyl ester, hydrochloride (1:1) ; Ethyl 1-benzyl-3-oxopiperidine-4-carboxylate hydrochloride (1:1) ; Ethyl-1-benzyl-3-oxopiperidin-4-carboxylathydrochlorid ; 1-Benzyl-4-carboethoxy-3-piperidone hydrochloride ; 1-Benzyl-4-ethoxycarbonyl-3-piperidone hydrochloride . It is a white to brown crystalline powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
