| Identification | |
| Name: | 8-Azabicyclo[3.2.1]octane,8-methyl- |
| Synonyms: | Tropane(6CI,7CI,8CI); 1aH,5aH-Tropane;2,3-Dihydro-8-methylnortropidine; 8-Methyl-8-azabicyclo[3.2.1]octane;N-Methyl-8-azabicyclo[3.2.1]octane |
| CAS: | 529-17-9 |
| Molecular Formula: | C8H15 N |
| Molecular Weight: | 125.21 |
| InChI: | InChI=1/C8H15N/c1-9-7-3-2-4-8(9)6-5-7/h7-8H,2-6H2,1H3/t7-,8+ |
| Molecular Structure: | ![(C8H15N) Tropane(6CI,7CI,8CI); 1aH,5aH-Tropane;2,3-Dihydro-8-methylnortropidine; 8-Methyl-8-azabicyclo[3.2.1]...](https://img1.guidechem.com/chem/e/dict/25/529-17-9.jpg) |
| Properties | |
| Transport: | UN 1993 3/PG 3 |
| Flash Point: | 42.2°C |
| Boiling Point: | 166°Cat760mmHg |
| Density: | 0.934g/cm3 |
| Refractive index: | n20/D 1.477(lit.) |
| Specification: |
Tropane with cas registry number of 529-17-9 is a nitrogenous bicyclic organic compound. It is mainly known for a group of alkaloids derived from it, which include atropine and cocaine. Both alkaloids contain tropinone from which tropane is a derivate. Tropane alkaloids occur in plants of the families Erythroxylaceae (including coca) and Solanaceae (including mandrake, henbane, deadly nightshade, datura, potato, tomato). Tropane is also known as 8-Azabicyclo(3.2.1)octane, 8-methyl- . |
| Packinggroup: | III |
| Flash Point: | 42.2°C |
| Safety Data | |
 |
|
