| Identification |
| Name: | Benzene,1-iodo-2-methoxy- |
| Synonyms: | Anisole,o-iodo- (7CI,8CI);1-Iodo-2-methoxybenzene;2-Iodophenyl methylether;2-Methoxy-1-iodobenzene;2-Methoxyiodobenzene;2-Methoxyphenyl iodide;NSC 9259;o-Anisyl iodide;o-Iodoanisole;o-Iodomethoxybenzene;o-Methoxyiodobenzene;o-Methoxyphenyl iodide; |
| CAS: | 529-28-2 |
| EINECS: | 208-456-4 |
| Molecular Formula: | C7H7IO |
| Molecular Weight: | 234.04 |
| InChI: | InChI=1/C7H7IO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 8 - 10 |
| Density: | 1.799 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. May discolor on exposure to air and light. |
| Refractive index: | 1.621-1.623 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | slight clear yellow liquid |
| HS Code: | 29093090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light and air. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
