| Identification | |
| Name: | Myricetin |
| CAS: | 529-44-2 |
| EINECS: | 208-463-2 |
| Molecular Formula: | C15H10O8 |
| Molecular Weight: | 318.2351 |
| InChI: | InChI=1S/C15H10O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,16-20,22H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.912 g/cm3 |
| Stability: | Stable under normal shipping and handling conditions. |
| Refractive index: | 1.864 |
| Water Solubility: | slightly soluble in Water |
| Solubility: | slightly soluble in Water |
| Appearance: | brown-yellow to brown-green crystalline powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Yellow needles from dilute alcohol |
| Usage: | Antioxidant flavonoid. |
| Safety Data | |
 |
|
