| Identification |
| Name: | 2H-1-Benzopyran-2-one,6,7-dihydroxy-4-methyl- |
| Synonyms: | Coumarin,6,7-dihydroxy-4-methyl- (7CI,8CI); Esculetin, 4-methyl- (6CI);4-Methyl-6,7-dihydroxycoumarin; 4-Methylaesculetin; 4-Methylesculetin;4-Methylesculetol; 6,7-Dihydroxy-4-methylcoumarin; Methylesculetin; NSC 11828;NSC 688807 |
| CAS: | 529-84-0 |
| EINECS: | 208-470-0 |
| Molecular Formula: | C10H8 O4 |
| Molecular Weight: | 192.16812 |
| InChI: | InChI=1S/C10H8O4/c1-5-2-10(13)14-9-4-8(12)7(11)3-6(5)9/h2-4,11-12H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.456 g/cm3 |
| Refractive index: | 1.651 |
| Water Solubility: | DMF: soluble in water |
| Solubility: | DMF: soluble in water |
| Appearance: | Yellow needle crystal |
| Specification: | GREY POWDER Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory.
|
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |