| Identification | |
| Name: | 3-Pyridinecarboxamide,2-chloro-N,N-dimethyl- |
| Synonyms: | 2-Chloro-N,N-dimethylnicotinamide;N,N-Dimethyl-2-chloronicotinamide; |
| CAS: | 52943-21-2 |
| Molecular Formula: | C8H9ClN2O |
| Molecular Weight: | 184.62286 |
| InChI: | InChI=1/C8H9ClN2O/c1-11(2)8(12)6-4-3-5-10-7(6)9/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.232 g/cm3 |
| Refractive index: | 1.548 |
| Specification: |
The 2-Chloro-N,N-dimethylnicotinamide with its cas register number is 52943-21-2. It also can be called as 2-Chloro-N,N-dimethyl-3-pyridinecarboxamide and the IUPAC Name about this chemical is 2-chloro-N,N-dimethylpyridine-3-carboxamide. It belongs to the pharmacetical. Physical properties about 2-Chloro-N,N-dimethylnicotinamide are: (1)ACD/LogP: 0.31; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 42; (5)ACD/KOC (pH 7.4): 42; (6)#H bond acceptors: 3; (7)#Freely Rotating Bonds: 1; (8)Polar Surface Area: 33.2Å2; (9)Index of Refraction: 1.548; (10)Molar Refractivity: 47.621 cm3; (11)Molar Volume: 149.898 cm3; (12)Polarizability: 18.879x10-24cm3; (13)Surface Tension: 44.863 dyne/cm; (14)Enthalpy of Vaporization: 57.327 kJ/mol. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
