| Identification | |
| Name: | 1,1'-Carbonyldiimidazole |
| CAS: | 530-62-1 |
| EINECS: | 208-488-9 |
| Molecular Formula: | C7H6N4O |
| Molecular Weight: | 162.15 |
| InChI: | InChI=1/C7H6N4O/c12-7(10-3-1-8-5-10)11-4-2-9-6-11/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3263 8/PG 2 |
| Density: | 1.39 g/cm3 |
| Stability: | Stable, but moisture-sensitive. Incompatible with acids, strong oxidizing agents, water. |
| Refractive index: | 1.665 |
| Solubility: | Very soluble |
| Appearance: | white crystalline powder |
| Specification: |
?N,N'-Carbonyldiimidazole , its cas register number is 530-62-1. It also can be called?1-Oxomethylenebis(N-imidazole) ; Carbonyl diimidazole ; Diimidazol-1-yl ketone?; N,N'-Carbonylbis(imidazole) ; 1,1'-Carbonylbis-1H-imidazole ; 1H-Imidazole, 1,1'-carbonylbis- ; Imidazole, 1,1'-carbonyldi- (8CI) ; Methanone, di-1H-imidazol-1-yl- .It is a?white crystalline powder. |
| Packinggroup: | III |
| HS Code: | 29332990 |
| Sensitive: | Moisture Sensitive |
| Usage: | Used in the synthesis of peptides. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
