| Identification | |
| Name: | Phenothiazin-5-ium,3-amino-7-(dimethylamino)-, chloride (1:1) |
| Synonyms: | Azure A(6CI);Phenothiazin-5-ium, 3-amino-7-(dimethylamino)-, chloride (8CI,9CI);3-Amino-7-(dimethylamino)phenazathionium chloride;5-Chloro-3-dimethylamino-7-amino-5H-phenothiazine;Azur A;Azurea dye;C.I.52005;N,N-Dimethylthionine; |
| CAS: | 531-53-3 |
| EINECS: | 208-510-7 |
| Molecular Formula: | C14H14ClN3S |
| Molecular Weight: | 291.79906 |
| InChI: | InChI=1S/C14H13N3S.ClH/c1-17(2)10-4-6-12-14(8-10)18-13-7-9(15)3-5-11(13)16-12;/h3-8,15H,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | moderate |
| Solubility: | moderate |
| Appearance: | green to dark brown powder |
| Specification: | green to dark brown powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
