| Identification | |
| Name: | 2(1H)-Pyridinone,5-methyl-1-phenyl- |
| Synonyms: | 5-Methyl-1-phenyl-1H-pyridin-2-one;5-Methyl-1-phenyl-2(1H)-pyridinone;5-Methyl-1-phenyl-2(1H)-pyridone;AMR 69;Deskar;Pirespa;Pirfenidone; |
| CAS: | 53179-13-8 |
| Molecular Formula: | C12H11NO |
| Molecular Weight: | 185.22184 |
| InChI: | InChI=1S/C12H11NO/c1-10-7-8-12(14)13(9-10)11-5-3-2-4-6-11/h2-9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 96-97ºC |
| Flash Point: | 152.7 ºC |
| Boiling Point: | 329.1ºC at 760 mmHg |
| Density: | 1.137 g/cm3 |
| Refractive index: | 1.592 |
| Appearance: | Off-White Solid |
| Specification: | Off-White Solid usageEng:Pirfenidone has demonstrated activity in multiple fibrotic conditions, including those of the lung, kidney and liver Safety Statements:36 36:Wear suitable protective clothing |
| Biological Activity: | Antifibrotic agent, effective in models of pulmonary and lung fibrosis. Inhibits collagen production and fibroblast proliferation. Regulates cytokine levels following oral administration in vivo . Potent scavenger of free radicals and inhibitor of lipid peroxidation. |
| Flash Point: | 152.7 ºC |
| Storage Temperature: | Store at RT |
| Usage: |
2(1H)-Pyridinone,5-methyl-1-phenyl- (CAS NO.53179-13-8) is used in multiple fibrotic conditions, including those of the lung, kidney and liver. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
