Identification |
Name: | Tropinone |
Synonyms: | 3-Tropanone; 8-Methyl-8-azabicyclo[3.2.1]octan-3-one; |
CAS: | 532-24-1 |
EINECS: | 208-530-6 |
Molecular Formula: | C8H13NO |
Molecular Weight: | 139.2 |
InChI: | InChI=1/C8H13NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-7H,2-5H2,1H3 |
Molecular Structure: |
|
Properties |
Transport: | 1544 |
Density: | 66 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.4598 (100 C) |
Solubility: | Very soluble |
Appearance: | Beige to brown crystalline powder. |
Packinggroup: | III |
HS Code: | 29399990 |
Color: | brown |
Usage: | Alkaloid. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|