| Identification | |
| Name: | Glycine, N-benzoyl-,sodium salt (1:1) |
| Synonyms: | Glycine,N-benzoyl-, monosodium salt (9CI); Hippuric acid, monosodium salt (8CI);Hippuric acid sodium salt; N-Benzoylglycine sodium salt; Sodium hippurate |
| CAS: | 532-94-5 |
| EINECS: | 208-548-4 |
| Molecular Formula: | C9H9 N O3 . Na |
| Molecular Weight: | 179.17266 |
| InChI: | InChI=1S/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Appearance: | white to off-white powder |
| Specification: | White crystalline powder Safety Statements:24/25-36/37-26-22 24/25:Avoid contact with skin and eyes 36/37:Wear suitable protective clothing and gloves 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust |
| Storage Temperature: | Store at RT. |
| Safety Data | |
 |
|
