| Identification | |
| Name: | Piperazine,1-[(3-methylphenyl)methyl]- |
| Synonyms: | Piperazine,1-(m-methylbenzyl)- (6CI,7CI,8CI);1-(3-Methylbenzyl)piperazine;1-(m-Methylbenzyl)piperazine;N-(m-Methylbenzyl)piperazine;NSC 30681; |
| CAS: | 5321-48-2 |
| EINECS: | 226-184-4 |
| Molecular Formula: | C12H18N2 |
| Molecular Weight: | 190.28 |
| InChI: | InChI=1/C12H18N2/c1-11-3-2-4-12(9-11)10-14-7-5-13-6-8-14/h2-4,9,13H,5-8,10H2,1H3/p+2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.011 g/cm3 |
| Refractive index: | n20/D 1.5400(lit.) |
| Appearance: | Pale Yellow Oil |
| Specification: | Pale Yellow Oil usageEng:Piperazine derivative used as reference materials for forensic laboratories. They affect the central and the autonomic nervous systems, the blood pressure, and smooth muscle. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | Refrigerator |
| Usage: | Piperazine derivative used as reference materials for forensic laboratories. They affect the central and the autonomic nervous systems, the blood pressure, and smooth muscle. |
| Safety Data | |
 |
|
