| Identification | |
| Name: | Acetic acid,2-(2,4-dichlorophenoxy)-, ethyl ester |
| Synonyms: | Acetic acid,(2,4-dichlorophenoxy)-, ethyl ester (6CI,8CI,9CI); 2,4-D ethyl ester; 2,4-DEE;2,4-PA-ethyl; Bladex C; Dicotox; Estone 80; Ethyl 2,4-dichlorophenoxyacetate;Ethyl 2-(2,4-dichlorophenoxy)acetate; Knochweed; Knock Weed; Knock Weed 4G;Weedone 40; Weedone Concentrate 48 |
| CAS: | 533-23-3 |
| EINECS: | 208-558-9 |
| Molecular Formula: | C10H10 Cl2 O3 |
| Molecular Weight: | 249.10 |
| InChI: | InChI=1/C10H10Cl2O3/c1-2-14-10(13)6-15-9-4-3-7(11)5-8(9)12/h3-5H,2,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3348 |
| Flash Point: | 127°C |
| Boiling Point: | 313.6°Cat760mmHg |
| Density: | 1.308g/cm3 |
| Refractive index: | 1.525 |
| Specification: | Safety Statements:26-36/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/39:Wear suitable protective clothing and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 127°C |
| Storage Temperature: | 0-6°C |
| Safety Data | |
 |
|
