| Identification |
| Name: | 2,3-Cyclopentenopyridine |
| Synonyms: | 6,7-Dihydro-5H-cyclopenta(b)pyridine;CPP;5H-Cyclopenta[b]pyridine,6,7-dihydro-; |
| CAS: | 533-37-9 |
| EINECS: | 208-564-1 |
| Molecular Formula: | C8H9N |
| Molecular Weight: | 119.16 |
| InChI: | InChI=1S/C8H9N/c1-3-7-4-2-6-9-8(7)5-1/h2,4,6H,1,3,5H2 |
| Molecular Structure: |
![(C8H9N) 6,7-Dihydro-5H-cyclopenta(b)pyridine;CPP;5H-Cyclopenta[b]pyridine,6,7-dihydro-;](https://img1.guidechem.com/chem/e/dict/17/533-37-9.jpg) |
| Properties |
| Density: | 1.066 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.544 |
| Appearance: | clear colorless to brownish liquid |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
