| Identification |
| Name: | Thiazole,5-(2-chloroethyl)-4-methyl- |
| Synonyms: | 4-Methyl-5-(b-chloroethyl)thiazole;5-(2-Chloroethyl)-4-methylthiazole;5-(b-Chloroethyl)-4-methylthiazole;Chlorethiazol;Chlorethiazole;Chlormethiazol;Chlormethiazole;Clomethiazole;Clomethiazolum;Distraneurin;Emineurina;Somnevrin; |
| CAS: | 533-45-9 |
| EINECS: | 208-565-7 |
| Molecular Formula: | C6H8ClNS |
| Molecular Weight: | 161.65 |
| InChI: | InChI=1/C6H8ClNS/c1-5-6(2-3-7)9-4-8-5/h4H,2-3H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.218 g/cm3 |
| Biological Activity: | Sedative and anticonvulsant which is neuroprotective in a number of animal models. Prevents the degeneration of serotonergic nerve terminals induced by MDMA ('Ecstasy'). |
| Storage Temperature: | Desiccate at RT |
| Safety Data |
| |
 |
