| Identification | |
| Name: | 2-Deoxy-D-ribose |
| Synonyms: | Thyminose;2.2-deoxy-D-ribose;(3R,4S)-3,4,5-trihydroxypentanal;2-Deoxyribose;2-Deoxy-alpha-D-ribopyranose;3,4,5-trihydroxypentanal;(3R,4R)-3,4,5-trihydroxypentanal;D-erythro-Pentose,2-deoxy-;2-Deoxy-beta-D-erythro-pentose;2-deoxy-d-ribose/thyminose;Deoxy-Ribose;2-Deoxy-D-arabinose;D-erythro-Pentose; |
| CAS: | 533-67-5 |
| EINECS: | 208-573-0 |
| Molecular Formula: | C5H10O4 |
| Molecular Weight: | 134.13 |
| InChI: | InChI=1/C5H10O4/c6-2-1-4(8)5(9)3-7/h2,4-5,7-9H,1,3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 20kgs |
| Density: | 1.516g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -57 o (C=1, H2O, 24HR) |
| Water Solubility: | soluble |
| Solubility: | Very soluble |
| Appearance: | white to off-white crystalline powder |
| HS Code: | 29400000 |
| Safety Data | |
| Hazard Symbols | |
 |
|
