| Identification | |
| Name: | Ng-monomethyl-l-arginine acetate |
| Synonyms: | L-Ornithine, N5-(imino(methylamino)methyl)-, monoacetate;(2S)-5-[(amino-methylazaniumylidene-methyl)amino]-2-azaniumyl-pentanoate;N(G)-Methyl-L-arginine acetate;N(G)-Monomethyl-L-arginine;acetic acid; (2S)-2-amino-5-[(N-methylcarbamimidoyl)amino]pentanoic acid;N5-(Imino(methylamino)methyl)-L-ornithine monoacetate;NG-METHYL-L-ARGININE ACETATE; |
| CAS: | 53308-83-1 |
| Molecular Formula: | C9H20N4O4 |
| Molecular Weight: | 248.2795 |
| InChI: | InChI=1S/C7H16N4O2.C2H4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13;1-2(3)4/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11);1H3,(H,3,4)/t5-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Water Solubility: | H2O: 1 mg/mL, clear, colorless |
| Solubility: | H2O: 1 mg/mL, clear, colorless |
| Appearance: | White to off-white solid. |
| Specification: | White Crystalline Powder usageEng:A potent inhibitor of NO synthase of adrenal glands, brain, and vascular endothelial cells Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Biological Activity: | Competitive, irreversible inhibitor of all three NOS isoforms. |
| Storage Temperature: | 2-8°C |
| Usage: | A potent inhibitor of NO synthase of adrenal glands, brain, and vascular endothelial cells |
| Safety Data | |
 |
|
