| Identification | |
| Name: | Docosanoic acid, sodiumsalt (1:1) |
| Synonyms: | Behenic acid, sodium salt; Sodium behenate; Sodiumdocosanoate |
| CAS: | 5331-77-1 |
| EINECS: | 226-234-5 |
| Molecular Formula: | C22H44 O2 . Na |
| Molecular Weight: | 362.56539 |
| InChI: | InChI=1/C14H12INO2/c1-18-13-7-3-6-12(9-13)16-14(17)10-4-2-5-11(15)8-10/h2-9H,1H3,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 79.95 deg C |
| Flash Point: | 176.3°C |
| Boiling Point: | 391.8°Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | 1.673 |
| Solubility: | 0.102 g are sol in 100 g of 90% ethanol at 17 deg C;0.218 g are sol in 100 ml of 91.5% ethanol at 25 deg C; 0.116 g are sol in 100 ml of 86.2% ethanol at 25 deg C; 0.011 g are sol in 100 ml of 63.07% ethanol at 25 deg C; 0.1922 g are sol in 100 g of ether at 16 deg C Slightly soluble in water, ethanol, ethyl ether In water, 160 mg/L, temp not specified |
| Flash Point: | 176.3°C |
| Color: | Waxy solid Needles |
| Safety Data | |
 |
|
