| Identification | |
| Name: | Toluenediisocyanate, trimethylolpropane, diethylene glycol polymer |
| Synonyms: | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)-, polymer with 1,3-diisocyanatomethylbenzene and 2,2-oxybisethanol;Diethylene glycol, trimethylol propane, 1,3-diisocyanatomethylbenzene polymer;Toluenediisocyanate, trimethylolpropane, diethylene glycol polymer |
| CAS: | 53317-61-6 |
| EINECS: | 500-120-8 |
| Molecular Formula: | C19H30N2O8 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H6N2O2.C6H14O3.C4H10O3/c1-7-8(10-5-12)3-2-4-9(7)11-6-13;1-2-6(3-7,4-8)5-9;5-1-3-7-4-2-6/h2-4H,1H3;7-9H,2-5H2,1H3;5-6H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.5°C |
| Boiling Point: | 248.4°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 110.5°C |
| Safety Data | |
 |
|
