| Identification | |
| Name: | Butane,1-bromo-2-methyl-, (2S)- |
| Synonyms: | Butane,1-bromo-2-methyl-, (S)-;Butane, 1-bromo-2-methyl-, (S)-(+)- (8CI);(+)-(S)-1-Bromo-2-methylbutane;(+)-1-Bromo-2-methylbutane;(+)-2-Methyl-1-bromobutane;(+)-2-Methylbutyl bromide;(S)-(+)-1-Bromo-2-methylbutane;(S)-(+)-2-Methyl-1-bromobutane;(S)-1-Bromo-2-methylbutane;(S)-2-Methyl-1-bromobutane;(S)-2-Methylbutylbromide;1-Bromo-2-(S)-methylbutane;S(+)-1-Bromo-2-methylbutane;d-Amylbromide; |
| CAS: | 534-00-9 |
| EINECS: | 208-583-5 |
| Molecular Formula: | C5H11Br |
| Molecular Weight: | 151.04 |
| InChI: | InChI=1/C5H11Br/c1-3-5(2)4-6/h5H,3-4H2,1-2H3/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Flash Point: | 22 ºC |
| Boiling Point: | 121-122 ºC |
| Density: | 1.223 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.445 |
| Alpha: | 4.5 º (C=5 IN CHLOROFORM) |
| Solubility: | Insoluble |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | II |
| Flash Point: | 22 ºC |
| Storage Temperature: | Keep tightly closed. Keep away from heat, sparks, and open flame. Store in a cool dry place. |
| Usage: | Used for the synthesis of chiral nematic liquid crystals and optically active grignard reagents. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
