| Identification |
| Name: | tris(2-hydroxyethyl)ammonium 2-(4-chloro-2-methylphenoxy)propionate |
| Synonyms: | Mecoprop-trolamine [ISO];Caswell No. 559A;EPA Pesticide Chemical Code 031516;Mecoprop-trolamine;Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);Tris(2-hydroxyethyl)ammonium 2-(4-chloro-2-methylphenoxy)propionate;2-(4-chloro-2-methylphenoxy)propanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| CAS: | 53404-61-8 |
| EINECS: | 258-535-2 |
| Molecular Formula: | C16H26ClNO6 |
| Molecular Weight: | 363.8337 |
| InChI: | InChI=1/C10H11ClO3.C6H15NO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;8-4-1-7(2-5-9)3-6-10/h3-5,7H,1-2H3,(H,12,13);8-10H,1-6H2 |
| Molecular Structure: |
![(C16H26ClNO6) Mecoprop-trolamine [ISO];Caswell No. 559A;EPA Pesticide Chemical Code 031516;Mecoprop-trolamine;Prop...](https://img.guidechem.com/pic/image/53404-61-8.gif) |
| Properties |
| Flash Point: | 154.5°C |
| Boiling Point: | 331.9°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 154.5°C |
| Safety Data |
| |
 |