Identification |
Name: | Acetic acid,2-thiocyanato-, ethyl ester |
Synonyms: | Aceticacid, thiocyanato-, ethyl ester (6CI,7CI,8CI,9CI); Ethyl thiocyanatoacetate;Ethyl thiocyanoacetate; NSC 1202; REE; REE (acetate); Thiocyanatoacetic acidethyl ester |
CAS: | 5349-28-0 |
Molecular Formula: | C5H7 N O2 S |
Molecular Weight: | 145.19 |
InChI: | InChI=1/C13H18O4/c1-7(14)17-13(12(15)16)10-3-8-2-9(5-10)6-11(13)4-8/h8-11H,2-6H2,1H3,(H,15,16) |
Molecular Structure: |
|
Properties |
Flash Point: | 89.4°C |
Boiling Point: | 224.1°Cat760mmHg |
Density: | 1.19g/cm3 |
Refractive index: | 1.547 |
Specification: |
The extinguishing agent of Thiocyanatoacetic acid ethyl ester (CAS No.5349-28-0) are dry powder, foam, sand, carbon dioxide, water mist.
|
Flash Point: | 89.4°C |
Safety Data |
|
|